About bis(9H-carbazole);propane
bis(9H-carbazole);propane (PubChem CID 90987002) has the molecular formula C27H26N2
and a molecular weight of 378.52 g/mol. Its IUPAC name is bis(9H-carbazole);propane.
Molecular Properties
| Compound Name | bis(9H-carbazole);propane |
| PubChem CID | 90987002 |
| Molecular Formula | C27H26N2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | bis(9H-carbazole);propane |
| SMILES | CCC.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/2C12H9N.C3H8/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-3-2/h2*1-8,13H;3H2,1-2H3 |
| InChIKey | TVLILXCBLZBQPT-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(9H-carbazole);propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-carbazole);propane?
The IUPAC name of bis(9H-carbazole);propane (CID 90987002) is bis(9H-carbazole);propane.
What is the SMILES notation for bis(9H-carbazole);propane?
The canonical SMILES for bis(9H-carbazole);propane is CCC.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of bis(9H-carbazole);propane?
The InChIKey is TVLILXCBLZBQPT-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9N.C3H8/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-3-2/h2*1-8,13H;3H2,1-2H3.
What are the key properties of bis(9H-carbazole);propane?
bis(9H-carbazole);propane has a molecular weight of 378.52 g/mol, XLogP of 8.06, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-carbazole);propane is sourced from PubChem (CID 90987002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).