About 9H-carbazole;9-ethylcarbazole
9H-carbazole;9-ethylcarbazole (PubChem CID 159391034) has the molecular formula C26H22N2
and a molecular weight of 362.48 g/mol. Its IUPAC name is 9H-carbazole;9-ethylcarbazole.
Molecular Properties
| Compound Name | 9H-carbazole;9-ethylcarbazole |
| PubChem CID | 159391034 |
| Molecular Formula | C26H22N2 |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 9H-carbazole;9-ethylcarbazole |
| SMILES | CCn1c2ccccc2c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C14H13N.C12H9N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h3-10H,2H2,1H3;1-8,13H |
| InChIKey | LMCRDQQOIRHZLH-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazole;9-ethylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;9-ethylcarbazole?
The IUPAC name of 9H-carbazole;9-ethylcarbazole (CID 159391034) is 9H-carbazole;9-ethylcarbazole.
What is the SMILES notation for 9H-carbazole;9-ethylcarbazole?
The canonical SMILES for 9H-carbazole;9-ethylcarbazole is CCn1c2ccccc2c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;9-ethylcarbazole?
The InChIKey is LMCRDQQOIRHZLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13N.C12H9N/c1-2-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h3-10H,2H2,1H3;1-8,13H.
What are the key properties of 9H-carbazole;9-ethylcarbazole?
9H-carbazole;9-ethylcarbazole has a molecular weight of 362.48 g/mol, XLogP of 7.14, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;9-ethylcarbazole is sourced from PubChem (CID 159391034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).