About 9H-carbazole;copper
9H-carbazole;copper (PubChem CID 159878189) has the molecular formula C12H9CuN
and a molecular weight of 230.76 g/mol. Its IUPAC name is 9H-carbazole;copper.
Molecular Properties
| Compound Name | 9H-carbazole;copper |
| PubChem CID | 159878189 |
| Molecular Formula | C12H9CuN |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.00 |
| IUPAC Name | 9H-carbazole;copper |
| SMILES | [Cu].c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.Cu/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8,13H; |
| InChIKey | NTELFBCTNQWGNC-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-carbazole;copper with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;copper?
The IUPAC name of 9H-carbazole;copper (CID 159878189) is 9H-carbazole;copper.
What is the SMILES notation for 9H-carbazole;copper?
The canonical SMILES for 9H-carbazole;copper is [Cu].c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;copper?
The InChIKey is NTELFBCTNQWGNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.Cu/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8,13H;.
What are the key properties of 9H-carbazole;copper?
9H-carbazole;copper has a molecular weight of 230.76 g/mol, XLogP of 3.32, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;copper is sourced from PubChem (CID 159878189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).