About 9H-carbazole;sulfuryl dichloride
9H-carbazole;sulfuryl dichloride (PubChem CID 158008992) has the molecular formula C12H9Cl2NO2S
and a molecular weight of 302.18 g/mol. Its IUPAC name is 9H-carbazole;sulfuryl dichloride.
Molecular Properties
| Compound Name | 9H-carbazole;sulfuryl dichloride |
| PubChem CID | 158008992 |
| Molecular Formula | C12H9Cl2NO2S |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 9H-carbazole;sulfuryl dichloride |
| SMILES | O=S(=O)(Cl)Cl.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.Cl2O2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-5(2,3)4/h1-8,13H; |
| InChIKey | FEQLVXRFQNACNS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-carbazole;sulfuryl dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;sulfuryl dichloride?
The IUPAC name of 9H-carbazole;sulfuryl dichloride (CID 158008992) is 9H-carbazole;sulfuryl dichloride.
What is the SMILES notation for 9H-carbazole;sulfuryl dichloride?
The canonical SMILES for 9H-carbazole;sulfuryl dichloride is O=S(=O)(Cl)Cl.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;sulfuryl dichloride?
The InChIKey is FEQLVXRFQNACNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.Cl2O2S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-5(2,3)4/h1-8,13H;.
What are the key properties of 9H-carbazole;sulfuryl dichloride?
9H-carbazole;sulfuryl dichloride has a molecular weight of 302.18 g/mol, XLogP of 4.03, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;sulfuryl dichloride is sourced from PubChem (CID 158008992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).