About 9H-carbazole;ethanol;methanesulfonic acid
9H-carbazole;ethanol;methanesulfonic acid (PubChem CID 174896622) has the molecular formula C15H19NO4S
and a molecular weight of 309.39 g/mol. Its IUPAC name is 9H-carbazole;ethanol;methanesulfonic acid.
Molecular Properties
| Compound Name | 9H-carbazole;ethanol;methanesulfonic acid |
| PubChem CID | 174896622 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 9H-carbazole;ethanol;methanesulfonic acid |
| SMILES | CCO.CS(=O)(=O)O.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C2H6O.CH4O3S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3;1-5(2,3)4/h1-8,13H;3H,2H2,1H3;1H3,(H,2,3,4) |
| InChIKey | FIQMKOWIBUKZCG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazole;ethanol;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;ethanol;methanesulfonic acid?
The IUPAC name of 9H-carbazole;ethanol;methanesulfonic acid (CID 174896622) is 9H-carbazole;ethanol;methanesulfonic acid.
What is the SMILES notation for 9H-carbazole;ethanol;methanesulfonic acid?
The canonical SMILES for 9H-carbazole;ethanol;methanesulfonic acid is CCO.CS(=O)(=O)O.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;ethanol;methanesulfonic acid?
The InChIKey is FIQMKOWIBUKZCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C2H6O.CH4O3S/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-3;1-5(2,3)4/h1-8,13H;3H,2H2,1H3;1H3,(H,2,3,4).
What are the key properties of 9H-carbazole;ethanol;methanesulfonic acid?
9H-carbazole;ethanol;methanesulfonic acid has a molecular weight of 309.39 g/mol, XLogP of 2.82, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;ethanol;methanesulfonic acid is sourced from PubChem (CID 174896622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).