About 9H-carbazole
9H-carbazole (PubChem CID 66668984) has the molecular formula C24H18N2
and a molecular weight of 334.42 g/mol. Its IUPAC name is 9H-carbazole.
Molecular Properties
| Compound Name | 9H-carbazole |
| PubChem CID | 66668984 |
| Molecular Formula | C24H18N2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 9H-carbazole |
| SMILES | c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/2C12H9N/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2*1-8,13H |
| InChIKey | KCOYLRXCNKJSSC-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole?
The IUPAC name of 9H-carbazole (CID 66668984) is 9H-carbazole.
What is the SMILES notation for 9H-carbazole?
The canonical SMILES for 9H-carbazole is c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole?
The InChIKey is KCOYLRXCNKJSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9N/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11/h2*1-8,13H.
What are the key properties of 9H-carbazole?
9H-carbazole has a molecular weight of 334.42 g/mol, XLogP of 6.64, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole is sourced from PubChem (CID 66668984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).