About 9H-carbazole;methanedithioic acid
9H-carbazole;methanedithioic acid (PubChem CID 158299126) has the molecular formula C13H11NS2
and a molecular weight of 245.37 g/mol. Its IUPAC name is 9H-carbazole;methanedithioic acid.
Molecular Properties
| Compound Name | 9H-carbazole;methanedithioic acid |
| PubChem CID | 158299126 |
| Molecular Formula | C13H11NS2 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 9H-carbazole;methanedithioic acid |
| SMILES | S=CS.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.CH2S2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1-3/h1-8,13H;1H,(H,2,3) |
| InChIKey | GMHBAIWFGRLNBZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 9H-carbazole;methanedithioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;methanedithioic acid?
The IUPAC name of 9H-carbazole;methanedithioic acid (CID 158299126) is 9H-carbazole;methanedithioic acid.
What is the SMILES notation for 9H-carbazole;methanedithioic acid?
The canonical SMILES for 9H-carbazole;methanedithioic acid is S=CS.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;methanedithioic acid?
The InChIKey is GMHBAIWFGRLNBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.CH2S2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1-3/h1-8,13H;1H,(H,2,3).
What are the key properties of 9H-carbazole;methanedithioic acid?
9H-carbazole;methanedithioic acid has a molecular weight of 245.37 g/mol, XLogP of 4.19, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;methanedithioic acid is sourced from PubChem (CID 158299126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).