9H-carbazole;carbonic acid

C13H11NO3 — CID 67577328

IUPAC9H-carbazole;carbonic acid
SMILESO=C(O)O.c1ccc2c(c1)[nH]c1ccccc12
InChIInChI=1S/C12H9N.CH2O3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1(3)4/h1-8,13H;(H2,2,3,4)
InChIKeyONWFRTDDHRZJNQ-UHFFFAOYSA-N
MW229.24 g/mol
LogP3.54
Rot. Bonds

About 9H-carbazole;carbonic acid

9H-carbazole;carbonic acid (PubChem CID 67577328) has the molecular formula C13H11NO3 and a molecular weight of 229.24 g/mol. Its IUPAC name is 9H-carbazole;carbonic acid.

Molecular Properties

Compound Name9H-carbazole;carbonic acid
PubChem CID67577328
Molecular FormulaC13H11NO3
Molecular Weight229.24 g/mol
Exact Mass229.07
IUPAC Name9H-carbazole;carbonic acid
SMILESO=C(O)O.c1ccc2c(c1)[nH]c1ccccc12
InChIInChI=1S/C12H9N.CH2O3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1(3)4/h1-8,13H;(H2,2,3,4)
InChIKeyONWFRTDDHRZJNQ-UHFFFAOYSA-N
XLogP3.54
TPSA73.32 Ų
H-Bond Donors3
H-Bond Acceptors1
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.24
LogP ≤ 53.54
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 101

Analyze 9H-carbazole;carbonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9H-carbazole;carbonic acid?
The IUPAC name of 9H-carbazole;carbonic acid (CID 67577328) is 9H-carbazole;carbonic acid.
What is the SMILES notation for 9H-carbazole;carbonic acid?
The canonical SMILES for 9H-carbazole;carbonic acid is O=C(O)O.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;carbonic acid?
The InChIKey is ONWFRTDDHRZJNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.CH2O3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1(3)4/h1-8,13H;(H2,2,3,4).
What are the key properties of 9H-carbazole;carbonic acid?
9H-carbazole;carbonic acid has a molecular weight of 229.24 g/mol, XLogP of 3.54, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;carbonic acid is sourced from PubChem (CID 67577328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).