About 9H-carbazole;carbonic acid
9H-carbazole;carbonic acid (PubChem CID 67577328) has the molecular formula C13H11NO3
and a molecular weight of 229.24 g/mol. Its IUPAC name is 9H-carbazole;carbonic acid.
Molecular Properties
| Compound Name | 9H-carbazole;carbonic acid |
| PubChem CID | 67577328 |
| Molecular Formula | C13H11NO3 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.07 |
| IUPAC Name | 9H-carbazole;carbonic acid |
| SMILES | O=C(O)O.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.CH2O3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1(3)4/h1-8,13H;(H2,2,3,4) |
| InChIKey | ONWFRTDDHRZJNQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9H-carbazole;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-carbazole;carbonic acid?
The IUPAC name of 9H-carbazole;carbonic acid (CID 67577328) is 9H-carbazole;carbonic acid.
What is the SMILES notation for 9H-carbazole;carbonic acid?
The canonical SMILES for 9H-carbazole;carbonic acid is O=C(O)O.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of 9H-carbazole;carbonic acid?
The InChIKey is ONWFRTDDHRZJNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.CH2O3/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;2-1(3)4/h1-8,13H;(H2,2,3,4).
What are the key properties of 9H-carbazole;carbonic acid?
9H-carbazole;carbonic acid has a molecular weight of 229.24 g/mol, XLogP of 3.54, 0 rotatable bonds, 3 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-carbazole;carbonic acid is sourced from PubChem (CID 67577328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).