About benzoic acid;9H-carbazole
benzoic acid;9H-carbazole (PubChem CID 162147282) has the molecular formula C19H15NO2
and a molecular weight of 289.33 g/mol. Its IUPAC name is benzoic acid;9H-carbazole.
Molecular Properties
| Compound Name | benzoic acid;9H-carbazole |
| PubChem CID | 162147282 |
| Molecular Formula | C19H15NO2 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | benzoic acid;9H-carbazole |
| SMILES | O=C(O)c1ccccc1.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/C12H9N.C7H6O2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;8-7(9)6-4-2-1-3-5-6/h1-8,13H;1-5H,(H,8,9) |
| InChIKey | ZKSNUWKZUAZBRY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze benzoic acid;9H-carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoic acid;9H-carbazole?
The IUPAC name of benzoic acid;9H-carbazole (CID 162147282) is benzoic acid;9H-carbazole.
What is the SMILES notation for benzoic acid;9H-carbazole?
The canonical SMILES for benzoic acid;9H-carbazole is O=C(O)c1ccccc1.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of benzoic acid;9H-carbazole?
The InChIKey is ZKSNUWKZUAZBRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N.C7H6O2/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;8-7(9)6-4-2-1-3-5-6/h1-8,13H;1-5H,(H,8,9).
What are the key properties of benzoic acid;9H-carbazole?
benzoic acid;9H-carbazole has a molecular weight of 289.33 g/mol, XLogP of 4.71, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzoic acid;9H-carbazole is sourced from PubChem (CID 162147282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).