About bis(9H-carbazole);ethane
bis(9H-carbazole);ethane (PubChem CID 145072085) has the molecular formula C26H24N2
and a molecular weight of 364.49 g/mol. Its IUPAC name is bis(9H-carbazole);ethane.
Molecular Properties
| Compound Name | bis(9H-carbazole);ethane |
| PubChem CID | 145072085 |
| Molecular Formula | C26H24N2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | bis(9H-carbazole);ethane |
| SMILES | CC.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12 |
| InChI | InChI=1S/2C12H9N.C2H6/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h2*1-8,13H;1-2H3 |
| InChIKey | MBODFSODZNWNGI-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(9H-carbazole);ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-carbazole);ethane?
The IUPAC name of bis(9H-carbazole);ethane (CID 145072085) is bis(9H-carbazole);ethane.
What is the SMILES notation for bis(9H-carbazole);ethane?
The canonical SMILES for bis(9H-carbazole);ethane is CC.c1ccc2c(c1)[nH]c1ccccc12.c1ccc2c(c1)[nH]c1ccccc12.
What is the InChIKey of bis(9H-carbazole);ethane?
The InChIKey is MBODFSODZNWNGI-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H9N.C2H6/c2*1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2/h2*1-8,13H;1-2H3.
What are the key properties of bis(9H-carbazole);ethane?
bis(9H-carbazole);ethane has a molecular weight of 364.49 g/mol, XLogP of 7.67, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-carbazole);ethane is sourced from PubChem (CID 145072085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).