About 10H-acridin-9-one;ethane
10H-acridin-9-one;ethane (PubChem CID 91525380) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 10H-acridin-9-one;ethane.
Molecular Properties
| Compound Name | 10H-acridin-9-one;ethane |
| PubChem CID | 91525380 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 10H-acridin-9-one;ethane |
| SMILES | CC.CC.O=c1c2ccccc2[nH]c2ccccc12 |
| InChI | InChI=1S/C13H9NO.2C2H6/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13;2*1-2/h1-8H,(H,14,15);2*1-2H3 |
| InChIKey | UXQZJHKBZSAMJP-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 10H-acridin-9-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-acridin-9-one;ethane?
The IUPAC name of 10H-acridin-9-one;ethane (CID 91525380) is 10H-acridin-9-one;ethane.
What is the SMILES notation for 10H-acridin-9-one;ethane?
The canonical SMILES for 10H-acridin-9-one;ethane is CC.CC.O=c1c2ccccc2[nH]c2ccccc12.
What is the InChIKey of 10H-acridin-9-one;ethane?
The InChIKey is UXQZJHKBZSAMJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9NO.2C2H6/c15-13-9-5-1-3-7-11(9)14-12-8-4-2-6-10(12)13;2*1-2/h1-8H,(H,14,15);2*1-2H3.
What are the key properties of 10H-acridin-9-one;ethane?
10H-acridin-9-one;ethane has a molecular weight of 255.36 g/mol, XLogP of 4.73, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-acridin-9-one;ethane is sourced from PubChem (CID 91525380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).