C21H12N2O4 — CID 18344486
7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-3-carboxylic acid (PubChem CID 18344486) has the molecular formula C21H12N2O4 and a molecular weight of 356.34 g/mol. Its IUPAC name is 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-3-carboxylic acid.
| Compound Name | 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18344486 |
| Molecular Formula | C21H12N2O4 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 7,14-dioxo-5,12-dihydroquinolino[2,3-b]acridine-3-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(=O)c3cc4[nH]c5ccccc5c(=O)c4cc3[nH]c2c1 |
| InChI | InChI=1S/C21H12N2O4/c24-19-11-3-1-2-4-15(11)22-17-8-14-18(9-13(17)19)23-16-7-10(21(26)27)5-6-12(16)20(14)25/h1-9H,(H,22,24)(H,23,25)(H,26,27) |
| InChIKey | PWXOIVAZQAOTMD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|