C24H24N2O2 — CID 90939428
5,12-dihydroquinolino[2,3-b]acridine-7,14-dione;ethane (PubChem CID 90939428) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is 5,12-dihydroquinolino[2,3-b]acridine-7,14-dione;ethane.
| Compound Name | 5,12-dihydroquinolino[2,3-b]acridine-7,14-dione;ethane |
|---|---|
| PubChem CID | 90939428 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 5,12-dihydroquinolino[2,3-b]acridine-7,14-dione;ethane |
| SMILES | CC.CC.O=c1c2ccccc2[nH]c2cc3c(=O)c4ccccc4[nH]c3cc12 |
| InChI | InChI=1S/C20H12N2O2.2C2H6/c23-19-11-5-1-3-7-15(11)21-17-10-14-18(9-13(17)19)22-16-8-4-2-6-12(16)20(14)24;2*1-2/h1-10H,(H,21,23)(H,22,24);2*1-2H3 |
| InChIKey | ZAXOZLUJKSGIHP-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|