C20H12N2O3 — CID 154309205
10,12-dihydro-5H-quinolino[2,3-b]acridine-7,9,14-trione (PubChem CID 154309205) has the molecular formula C20H12N2O3 and a molecular weight of 328.33 g/mol. Its IUPAC name is 10,12-dihydro-5H-quinolino[2,3-b]acridine-7,9,14-trione.
| Compound Name | 10,12-dihydro-5H-quinolino[2,3-b]acridine-7,9,14-trione |
|---|---|
| PubChem CID | 154309205 |
| Molecular Formula | C20H12N2O3 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 10,12-dihydro-5H-quinolino[2,3-b]acridine-7,9,14-trione |
| SMILES | O=C1C=c2c([nH]c3cc4c(=O)c5ccccc5[nH]c4cc3c2=O)=CC1 |
| InChI | InChI=1S/C20H12N2O3/c23-10-5-6-16-12(7-10)20(25)14-9-17-13(8-18(14)22-16)19(24)11-3-1-2-4-15(11)21-17/h1-4,6-9,22H,5H2,(H,21,24) |
| InChIKey | COFNRAOIOQCZQB-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|