C23H15NO2 — CID 89328403
(23E)-11-azapentacyclo[12.10.0.03,12.05,10.016,21]tetracosa-1,3(12),5,7,9,13,16,18,20,23-decaene-4,15-dione (PubChem CID 89328403) has the molecular formula C23H15NO2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (23E)-11-azapentacyclo[12.10.0.03,12.05,10.016,21]tetracosa-1,3(12),5,7,9,13,16,18,20,23-decaene-4,15-dione.
| Compound Name | (23E)-11-azapentacyclo[12.10.0.03,12.05,10.016,21]tetracosa-1,3(12),5,7,9,13,16,18,20,23-decaene-4,15-dione |
|---|---|
| PubChem CID | 89328403 |
| Molecular Formula | C23H15NO2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (23E)-11-azapentacyclo[12.10.0.03,12.05,10.016,21]tetracosa-1,3(12),5,7,9,13,16,18,20,23-decaene-4,15-dione |
| SMILES | O=C1c2cc3[nH]c4ccccc4c(=O)c3cc2/C=C\Cc2ccccc21 |
| InChI | InChI=1S/C23H15NO2/c25-22-16-9-2-1-6-14(16)7-5-8-15-12-19-21(13-18(15)22)24-20-11-4-3-10-17(20)23(19)26/h1-6,8-13H,7H2,(H,24,26)/b8-5- |
| InChIKey | RZOSHLTZIGAGTB-YVMONPNESA-N |
| XLogP | 4.48 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|