C16H11NO — CID 123961016
5,6-dihydrobenzo[b]carbazol-11-one (PubChem CID 123961016) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is 5,6-dihydrobenzo[b]carbazol-11-one.
| Compound Name | 5,6-dihydrobenzo[b]carbazol-11-one |
|---|---|
| PubChem CID | 123961016 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 5,6-dihydrobenzo[b]carbazol-11-one |
| SMILES | O=C1c2ccccc2Cc2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C16H11NO/c18-16-11-6-2-1-5-10(11)9-14-15(16)12-7-3-4-8-13(12)17-14/h1-8,17H,9H2 |
| InChIKey | LRGWDDQANOEEAH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |