C15H9NO — CID 2785776
5H-indeno[1,2-b]indol-10-one (PubChem CID 2785776) has the molecular formula C15H9NO and a molecular weight of 219.24 g/mol. Its IUPAC name is 5H-indeno[1,2-b]indol-10-one.
| Compound Name | 5H-indeno[1,2-b]indol-10-one |
|---|---|
| PubChem CID | 2785776 |
| Molecular Formula | C15H9NO |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | 5H-indeno[1,2-b]indol-10-one |
| SMILES | O=C1c2ccccc2-c2[nH]c3ccccc3c21 |
| InChI | InChI=1S/C15H9NO/c17-15-10-6-2-1-5-9(10)14-13(15)11-7-3-4-8-12(11)16-14/h1-8,16H |
| InChIKey | NHOZLQCFHOVMLW-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |