C28H20N2 — CID 145241572
(17Z)-17,18-bis(ethenyl)-15,26-diazahexacyclo[17.7.0.02,7.08,16.09,14.020,25]hexacosa-1(19),2,4,6,8(16),9,11,13,17,20,22,24-dodecaene (PubChem CID 145241572) has the molecular formula C28H20N2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (17Z)-17,18-bis(ethenyl)-15,26-diazahexacyclo[17.7.0.02,7.08,16.09,14.020,25]hexacosa-1(19),2,4,6,8(16),9,11,13,17,20,22,24-dodecaene.
| Compound Name | (17Z)-17,18-bis(ethenyl)-15,26-diazahexacyclo[17.7.0.02,7.08,16.09,14.020,25]hexacosa-1(19),2,4,6,8(16),9,11,13,17,20,22,24-dodecaene |
|---|---|
| PubChem CID | 145241572 |
| Molecular Formula | C28H20N2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (17Z)-17,18-bis(ethenyl)-15,26-diazahexacyclo[17.7.0.02,7.08,16.09,14.020,25]hexacosa-1(19),2,4,6,8(16),9,11,13,17,20,22,24-dodecaene |
| SMILES | C=C/C1=C(\C=C)c2c([nH]c3ccccc23)-c2ccccc2-c2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C28H20N2/c1-3-17-18(4-2)27-26(22-14-8-10-16-24(22)29-27)19-11-5-6-12-20(19)28-25(17)21-13-7-9-15-23(21)30-28/h3-16,29-30H,1-2H2/b18-17-,25-17-,26-19-,27-18+,28-20+ |
| InChIKey | TYRDHHSRNLOAAC-HZCKISSQSA-N |
| XLogP | 7.58 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |