C18H13NO2 — CID 11807923
2,3-dimethyl-11H-benzo[a]carbazole-5,6-dione (PubChem CID 11807923) has the molecular formula C18H13NO2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 2,3-dimethyl-11H-benzo[a]carbazole-5,6-dione.
| Compound Name | 2,3-dimethyl-11H-benzo[a]carbazole-5,6-dione |
|---|---|
| PubChem CID | 11807923 |
| Molecular Formula | C18H13NO2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 2,3-dimethyl-11H-benzo[a]carbazole-5,6-dione |
| SMILES | Cc1cc2c(cc1C)-c1[nH]c3ccccc3c1C(=O)C2=O |
| InChI | InChI=1S/C18H13NO2/c1-9-7-12-13(8-10(9)2)17(20)18(21)15-11-5-3-4-6-14(11)19-16(12)15/h3-8,19H,1-2H3 |
| InChIKey | GOPVHDCXHGANBU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|