C17H11NO2S — CID 11779161
2-methyl-1-thiophen-2-yl-9H-carbazole-3,4-dione (PubChem CID 11779161) has the molecular formula C17H11NO2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-methyl-1-thiophen-2-yl-9H-carbazole-3,4-dione.
| Compound Name | 2-methyl-1-thiophen-2-yl-9H-carbazole-3,4-dione |
|---|---|
| PubChem CID | 11779161 |
| Molecular Formula | C17H11NO2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-methyl-1-thiophen-2-yl-9H-carbazole-3,4-dione |
| SMILES | CC1=C(c2cccs2)c2[nH]c3ccccc3c2C(=O)C1=O |
| InChI | InChI=1S/C17H11NO2S/c1-9-13(12-7-4-8-21-12)15-14(17(20)16(9)19)10-5-2-3-6-11(10)18-15/h2-8,18H,1H3 |
| InChIKey | NZWPKSPBQOHBBS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|