C20H15NO2S — CID 50916853
4-phenylmethoxy-3-thiophen-2-yl-1H-quinolin-2-one (PubChem CID 50916853) has the molecular formula C20H15NO2S and a molecular weight of 333.41 g/mol. Its IUPAC name is 4-phenylmethoxy-3-thiophen-2-yl-1H-quinolin-2-one.
| Compound Name | 4-phenylmethoxy-3-thiophen-2-yl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 50916853 |
| Molecular Formula | C20H15NO2S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 4-phenylmethoxy-3-thiophen-2-yl-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccccc2c(OCc2ccccc2)c1-c1cccs1 |
| InChI | InChI=1S/C20H15NO2S/c22-20-18(17-11-6-12-24-17)19(15-9-4-5-10-16(15)21-20)23-13-14-7-2-1-3-8-14/h1-12H,13H2,(H,21,22) |
| InChIKey | IVXHRWLXQKPTQE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |