About ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate
ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate (PubChem CID 177406339) has the molecular formula C18H14N2O3S
and a molecular weight of 338.39 g/mol. Its IUPAC name is ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate |
| PubChem CID | 177406339 |
| Molecular Formula | C18H14N2O3S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c2[nH]c3ccccc3c(=O)c2c1-c1cccs1 |
| InChI | InChI=1S/C18H14N2O3S/c1-2-23-18(22)15-13(12-8-5-9-24-12)14-16(21)10-6-3-4-7-11(10)19-17(14)20-15/h3-9H,2H2,1H3,(H2,19,20,21) |
| InChIKey | SAUNMHLVYJXHEP-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate?
The IUPAC name of ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate (CID 177406339) is ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate.
What is the SMILES notation for ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate?
The canonical SMILES for ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate is CCOC(=O)c1[nH]c2[nH]c3ccccc3c(=O)c2c1-c1cccs1.
What is the InChIKey of ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate?
The InChIKey is SAUNMHLVYJXHEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N2O3S/c1-2-23-18(22)15-13(12-8-5-9-24-12)14-16(21)10-6-3-4-7-11(10)19-17(14)20-15/h3-9H,2H2,1H3,(H2,19,20,21).
What are the key properties of ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate?
ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate has a molecular weight of 338.39 g/mol, XLogP of 3.91, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-oxo-3-thiophen-2-yl-1,9-dihydropyrrolo[2,3-b]quinoline-2-carboxylate is sourced from PubChem (CID 177406339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).