C13H15NO2S — CID 13380754
ethyl 2,5-dimethyl-4-thiophen-2-yl-1H-pyrrole-3-carboxylate (PubChem CID 13380754) has the molecular formula C13H15NO2S and a molecular weight of 249.33 g/mol. Its IUPAC name is ethyl 2,5-dimethyl-4-thiophen-2-yl-1H-pyrrole-3-carboxylate.
| Compound Name | ethyl 2,5-dimethyl-4-thiophen-2-yl-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 13380754 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | ethyl 2,5-dimethyl-4-thiophen-2-yl-1H-pyrrole-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)[nH]c(C)c1-c1cccs1 |
| InChI | InChI=1S/C13H15NO2S/c1-4-16-13(15)12-9(3)14-8(2)11(12)10-6-5-7-17-10/h5-7,14H,4H2,1-3H3 |
| InChIKey | DGXDCPXZDUDCBY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |