C16H13NO4S2 — CID 102258239
dimethyl 3,4-dithiophen-2-yl-1H-pyrrole-2,5-dicarboxylate (PubChem CID 102258239) has the molecular formula C16H13NO4S2 and a molecular weight of 347.42 g/mol. Its IUPAC name is dimethyl 3,4-dithiophen-2-yl-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 3,4-dithiophen-2-yl-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 102258239 |
| Molecular Formula | C16H13NO4S2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | dimethyl 3,4-dithiophen-2-yl-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2cccs2)c1-c1cccs1 |
| InChI | InChI=1S/C16H13NO4S2/c1-20-15(18)13-11(9-5-3-7-22-9)12(10-6-4-8-23-10)14(17-13)16(19)21-2/h3-8,17H,1-2H3 |
| InChIKey | CDARPKOAXULHJM-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 68.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |