About dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate
dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate (PubChem CID 11004400) has the molecular formula C18H20N2O10
and a molecular weight of 424.36 g/mol. Its IUPAC name is dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate.
Molecular Properties
| Compound Name | dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
| PubChem CID | 11004400 |
| Molecular Formula | C18H20N2O10 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2c(C(=O)OC)[nH]c(C(=O)OC)c2OC)c1OC |
| InChI | InChI=1S/C18H20N2O10/c1-25-13-7(9(15(21)27-3)19-11(13)17(23)29-5)8-10(16(22)28-4)20-12(14(8)26-2)18(24)30-6/h19-20H,1-6H3 |
| InChIKey | LGLIQOWSKCPJSN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate?
The IUPAC name of dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate (CID 11004400) is dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate.
What is the SMILES notation for dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate?
The canonical SMILES for dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate is COC(=O)c1[nH]c(C(=O)OC)c(-c2c(C(=O)OC)[nH]c(C(=O)OC)c2OC)c1OC.
What is the InChIKey of dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate?
The InChIKey is LGLIQOWSKCPJSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O10/c1-25-13-7(9(15(21)27-3)19-11(13)17(23)29-5)8-10(16(22)28-4)20-12(14(8)26-2)18(24)30-6/h19-20H,1-6H3.
What are the key properties of dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate?
dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate has a molecular weight of 424.36 g/mol, XLogP of 1.17, 7 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate is sourced from PubChem (CID 11004400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).