C18H20N2O10 — CID 11004400
dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate (PubChem CID 11004400) has the molecular formula C18H20N2O10 and a molecular weight of 424.36 g/mol. Its IUPAC name is dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate.
| Compound Name | dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
|---|---|
| PubChem CID | 11004400 |
| Molecular Formula | C18H20N2O10 |
| Molecular Weight | 424.36 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | dimethyl 3-methoxy-4-[4-methoxy-2,5-bis(methoxycarbonyl)-1H-pyrrol-3-yl]-1H-pyrrole-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]c(C(=O)OC)c(-c2c(C(=O)OC)[nH]c(C(=O)OC)c2OC)c1OC |
| InChI | InChI=1S/C18H20N2O10/c1-25-13-7(9(15(21)27-3)19-11(13)17(23)29-5)8-10(16(22)28-4)20-12(14(8)26-2)18(24)30-6/h19-20H,1-6H3 |
| InChIKey | LGLIQOWSKCPJSN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 155.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.36 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|