C10H11NO6 — CID 126633344
dimethyl 3-methoxy-4-oxo-1H-pyridine-2,5-dicarboxylate (PubChem CID 126633344) has the molecular formula C10H11NO6 and a molecular weight of 241.20 g/mol. Its IUPAC name is dimethyl 3-methoxy-4-oxo-1H-pyridine-2,5-dicarboxylate.
| Compound Name | dimethyl 3-methoxy-4-oxo-1H-pyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 126633344 |
| Molecular Formula | C10H11NO6 |
| Molecular Weight | 241.20 g/mol |
| Exact Mass | 241.06 |
| IUPAC Name | dimethyl 3-methoxy-4-oxo-1H-pyridine-2,5-dicarboxylate |
| SMILES | COC(=O)c1[nH]cc(C(=O)OC)c(=O)c1OC |
| InChI | InChI=1S/C10H11NO6/c1-15-8-6(10(14)17-3)11-4-5(7(8)12)9(13)16-2/h4H,1-3H3,(H,11,12) |
| InChIKey | WKAXUTPMYVARIF-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 94.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.20 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |