C15H13NO5 — CID 59600568
methyl 6-formyl-4-oxo-5-phenylmethoxy-1H-pyridine-3-carboxylate (PubChem CID 59600568) has the molecular formula C15H13NO5 and a molecular weight of 287.27 g/mol. Its IUPAC name is methyl 6-formyl-4-oxo-5-phenylmethoxy-1H-pyridine-3-carboxylate.
| Compound Name | methyl 6-formyl-4-oxo-5-phenylmethoxy-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 59600568 |
| Molecular Formula | C15H13NO5 |
| Molecular Weight | 287.27 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | methyl 6-formyl-4-oxo-5-phenylmethoxy-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)c1c[nH]c(C=O)c(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C15H13NO5/c1-20-15(19)11-7-16-12(8-17)14(13(11)18)21-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,16,18) |
| InChIKey | VSIWILTWGMITHG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 85.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|