C19H21NO8 — CID 134830452
1-(2,2-dimethoxyethyl)-6-methoxycarbonyl-4-oxo-5-phenylmethoxypyridine-3-carboxylic acid (PubChem CID 134830452) has the molecular formula C19H21NO8 and a molecular weight of 391.38 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-6-methoxycarbonyl-4-oxo-5-phenylmethoxypyridine-3-carboxylic acid.
| Compound Name | 1-(2,2-dimethoxyethyl)-6-methoxycarbonyl-4-oxo-5-phenylmethoxypyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 134830452 |
| Molecular Formula | C19H21NO8 |
| Molecular Weight | 391.38 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-6-methoxycarbonyl-4-oxo-5-phenylmethoxypyridine-3-carboxylic acid |
| SMILES | COC(=O)c1c(OCc2ccccc2)c(=O)c(C(=O)O)cn1CC(OC)OC |
| InChI | InChI=1S/C19H21NO8/c1-25-14(26-2)10-20-9-13(18(22)23)16(21)17(15(20)19(24)27-3)28-11-12-7-5-4-6-8-12/h4-9,14H,10-11H2,1-3H3,(H,22,23) |
| InChIKey | HDJZLVRNTJZNRI-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.38 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|