C25H26ClN3O7 — CID 21091367
[6-[(3-chlorophenyl)methylcarbamoyl]-1-(2,2-dimethoxyethyl)-4-oxo-5-phenylmethoxy-3-pyridinyl]carbamic acid (PubChem CID 21091367) has the molecular formula C25H26ClN3O7 and a molecular weight of 515.95 g/mol. Its IUPAC name is [6-[(3-chlorophenyl)methylcarbamoyl]-1-(2,2-dimethoxyethyl)-4-oxo-5-phenylmethoxy-3-pyridinyl]carbamic acid.
| Compound Name | [6-[(3-chlorophenyl)methylcarbamoyl]-1-(2,2-dimethoxyethyl)-4-oxo-5-phenylmethoxy-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 21091367 |
| Molecular Formula | C25H26ClN3O7 |
| Molecular Weight | 515.95 g/mol |
| Exact Mass | 515.15 |
| IUPAC Name | [6-[(3-chlorophenyl)methylcarbamoyl]-1-(2,2-dimethoxyethyl)-4-oxo-5-phenylmethoxy-3-pyridinyl]carbamic acid |
| SMILES | COC(Cn1cc(NC(=O)O)c(=O)c(OCc2ccccc2)c1C(=O)NCc1cccc(Cl)c1)OC |
| InChI | InChI=1S/C25H26ClN3O7/c1-34-20(35-2)14-29-13-19(28-25(32)33)22(30)23(36-15-16-7-4-3-5-8-16)21(29)24(31)27-12-17-9-6-10-18(26)11-17/h3-11,13,20,28H,12,14-15H2,1-2H3,(H,27,31)(H,32,33) |
| InChIKey | BHZDIHPENJYRHL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 128.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.95 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|