C20H16ClNO4 — CID 45490762
N-[(3-chlorophenyl)methyl]-4-oxo-5-phenylmethoxypyran-2-carboxamide (PubChem CID 45490762) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-oxo-5-phenylmethoxypyran-2-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-oxo-5-phenylmethoxypyran-2-carboxamide |
|---|---|
| PubChem CID | 45490762 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-oxo-5-phenylmethoxypyran-2-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)c1cc(=O)c(OCc2ccccc2)co1 |
| InChI | InChI=1S/C20H16ClNO4/c21-16-8-4-7-15(9-16)11-22-20(24)18-10-17(23)19(13-26-18)25-12-14-5-2-1-3-6-14/h1-10,13H,11-12H2,(H,22,24) |
| InChIKey | QXKNYDLPQVRZCB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |