C20H16N2O5 — CID 42227017
N-(2-carbamoylphenyl)-4-oxo-5-phenylmethoxypyran-2-carboxamide (PubChem CID 42227017) has the molecular formula C20H16N2O5 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-(2-carbamoylphenyl)-4-oxo-5-phenylmethoxypyran-2-carboxamide.
| Compound Name | N-(2-carbamoylphenyl)-4-oxo-5-phenylmethoxypyran-2-carboxamide |
|---|---|
| PubChem CID | 42227017 |
| Molecular Formula | C20H16N2O5 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N-(2-carbamoylphenyl)-4-oxo-5-phenylmethoxypyran-2-carboxamide |
| SMILES | NC(=O)c1ccccc1NC(=O)c1cc(=O)c(OCc2ccccc2)co1 |
| InChI | InChI=1S/C20H16N2O5/c21-19(24)14-8-4-5-9-15(14)22-20(25)17-10-16(23)18(12-27-17)26-11-13-6-2-1-3-7-13/h1-10,12H,11H2,(H2,21,24)(H,22,25) |
| InChIKey | NJOHDYZTPWTPIX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 111.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |