C19H14FNO4 — CID 86206858
5-[(2-fluorophenyl)methoxy]-4-oxo-N-phenylpyran-2-carboxamide (PubChem CID 86206858) has the molecular formula C19H14FNO4 and a molecular weight of 339.32 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)methoxy]-4-oxo-N-phenylpyran-2-carboxamide.
| Compound Name | 5-[(2-fluorophenyl)methoxy]-4-oxo-N-phenylpyran-2-carboxamide |
|---|---|
| PubChem CID | 86206858 |
| Molecular Formula | C19H14FNO4 |
| Molecular Weight | 339.32 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | 5-[(2-fluorophenyl)methoxy]-4-oxo-N-phenylpyran-2-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1cc(=O)c(OCc2ccccc2F)co1 |
| InChI | InChI=1S/C19H14FNO4/c20-15-9-5-4-6-13(15)11-24-18-12-25-17(10-16(18)22)19(23)21-14-7-2-1-3-8-14/h1-10,12H,11H2,(H,21,23) |
| InChIKey | PDSDSYUAUCTEJU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.32 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |