C19H13F2NO4 — CID 42227224
N-(4-fluorophenyl)-5-[(4-fluorophenyl)methoxy]-4-oxopyran-2-carboxamide (PubChem CID 42227224) has the molecular formula C19H13F2NO4 and a molecular weight of 357.31 g/mol. Its IUPAC name is N-(4-fluorophenyl)-5-[(4-fluorophenyl)methoxy]-4-oxopyran-2-carboxamide.
| Compound Name | N-(4-fluorophenyl)-5-[(4-fluorophenyl)methoxy]-4-oxopyran-2-carboxamide |
|---|---|
| PubChem CID | 42227224 |
| Molecular Formula | C19H13F2NO4 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | N-(4-fluorophenyl)-5-[(4-fluorophenyl)methoxy]-4-oxopyran-2-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1)c1cc(=O)c(OCc2ccc(F)cc2)co1 |
| InChI | InChI=1S/C19H13F2NO4/c20-13-3-1-12(2-4-13)10-25-18-11-26-17(9-16(18)23)19(24)22-15-7-5-14(21)6-8-15/h1-9,11H,10H2,(H,22,24) |
| InChIKey | YIOSLXPDGVCDPB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |