C21H18FNO4 — CID 42227199
5-[(4-fluorophenyl)methoxy]-4-oxo-N-[(1S)-1-phenylethyl]pyran-2-carboxamide (PubChem CID 42227199) has the molecular formula C21H18FNO4 and a molecular weight of 367.38 g/mol. Its IUPAC name is 5-[(4-fluorophenyl)methoxy]-4-oxo-N-[(1S)-1-phenylethyl]pyran-2-carboxamide.
| Compound Name | 5-[(4-fluorophenyl)methoxy]-4-oxo-N-[(1S)-1-phenylethyl]pyran-2-carboxamide |
|---|---|
| PubChem CID | 42227199 |
| Molecular Formula | C21H18FNO4 |
| Molecular Weight | 367.38 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | 5-[(4-fluorophenyl)methoxy]-4-oxo-N-[(1S)-1-phenylethyl]pyran-2-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(=O)c(OCc2ccc(F)cc2)co1)c1ccccc1 |
| InChI | InChI=1S/C21H18FNO4/c1-14(16-5-3-2-4-6-16)23-21(25)19-11-18(24)20(13-27-19)26-12-15-7-9-17(22)10-8-15/h2-11,13-14H,12H2,1H3,(H,23,25)/t14-/m0/s1 |
| InChIKey | MQQFCVPEIKFDOV-AWEZNQCLSA-N |
| XLogP | 3.85 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |