C25H25NO4 — CID 174458853
3-[4-[[2-(1-phenylethylcarbamoyl)phenoxy]methyl]phenyl]propanoic acid (PubChem CID 174458853) has the molecular formula C25H25NO4 and a molecular weight of 403.48 g/mol. Its IUPAC name is 3-[4-[[2-(1-phenylethylcarbamoyl)phenoxy]methyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[[2-(1-phenylethylcarbamoyl)phenoxy]methyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 174458853 |
| Molecular Formula | C25H25NO4 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | 3-[4-[[2-(1-phenylethylcarbamoyl)phenoxy]methyl]phenyl]propanoic acid |
| SMILES | CC(NC(=O)c1ccccc1OCc1ccc(CCC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO4/c1-18(21-7-3-2-4-8-21)26-25(29)22-9-5-6-10-23(22)30-17-20-13-11-19(12-14-20)15-16-24(27)28/h2-14,18H,15-17H2,1H3,(H,26,29)(H,27,28) |
| InChIKey | YUPCREZSTXIPLO-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |