C24H23FN2O2 — CID 92540793
2-[3-(4-fluorophenyl)propanoylamino]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 92540793) has the molecular formula C24H23FN2O2 and a molecular weight of 390.46 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)propanoylamino]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 2-[3-(4-fluorophenyl)propanoylamino]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 92540793 |
| Molecular Formula | C24H23FN2O2 |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2-[3-(4-fluorophenyl)propanoylamino]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | C[C@H](NC(=O)c1ccccc1NC(=O)CCc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23FN2O2/c1-17(19-7-3-2-4-8-19)26-24(29)21-9-5-6-10-22(21)27-23(28)16-13-18-11-14-20(25)15-12-18/h2-12,14-15,17H,13,16H2,1H3,(H,26,29)(H,27,28)/t17-/m0/s1 |
| InChIKey | XBAKTJNLEVHYFW-KRWDZBQOSA-N |
| XLogP | 4.89 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |