C29H26N2O2 — CID 100515353
N-[(1R)-1-phenylethyl]-2-[[2-(4-phenylphenyl)acetyl]amino]benzamide (PubChem CID 100515353) has the molecular formula C29H26N2O2 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-2-[[2-(4-phenylphenyl)acetyl]amino]benzamide.
| Compound Name | N-[(1R)-1-phenylethyl]-2-[[2-(4-phenylphenyl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 100515353 |
| Molecular Formula | C29H26N2O2 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-2-[[2-(4-phenylphenyl)acetyl]amino]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccccc1NC(=O)Cc1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C29H26N2O2/c1-21(23-10-4-2-5-11-23)30-29(33)26-14-8-9-15-27(26)31-28(32)20-22-16-18-25(19-17-22)24-12-6-3-7-13-24/h2-19,21H,20H2,1H3,(H,30,33)(H,31,32)/t21-/m1/s1 |
| InChIKey | RMDJQYKBDQNEMQ-OAQYLSRUSA-N |
| XLogP | 6.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |