C27H28N2O4 — CID 4946844
2-phenylethyl 4-oxo-4-[2-(1-phenylethylcarbamoyl)anilino]butanoate (PubChem CID 4946844) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-phenylethyl 4-oxo-4-[2-(1-phenylethylcarbamoyl)anilino]butanoate.
| Compound Name | 2-phenylethyl 4-oxo-4-[2-(1-phenylethylcarbamoyl)anilino]butanoate |
|---|---|
| PubChem CID | 4946844 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-phenylethyl 4-oxo-4-[2-(1-phenylethylcarbamoyl)anilino]butanoate |
| SMILES | CC(NC(=O)c1ccccc1NC(=O)CCC(=O)OCCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H28N2O4/c1-20(22-12-6-3-7-13-22)28-27(32)23-14-8-9-15-24(23)29-25(30)16-17-26(31)33-19-18-21-10-4-2-5-11-21/h2-15,20H,16-19H2,1H3,(H,28,32)(H,29,30) |
| InChIKey | GNMAWKGYCWQWCY-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |