C18H12Cl2N2O4 — CID 45493609
5-[(3,4-dichlorophenyl)methoxy]-4-oxo-N-pyridin-3-ylpyran-2-carboxamide (PubChem CID 45493609) has the molecular formula C18H12Cl2N2O4 and a molecular weight of 391.21 g/mol. Its IUPAC name is 5-[(3,4-dichlorophenyl)methoxy]-4-oxo-N-pyridin-3-ylpyran-2-carboxamide.
| Compound Name | 5-[(3,4-dichlorophenyl)methoxy]-4-oxo-N-pyridin-3-ylpyran-2-carboxamide |
|---|---|
| PubChem CID | 45493609 |
| Molecular Formula | C18H12Cl2N2O4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 5-[(3,4-dichlorophenyl)methoxy]-4-oxo-N-pyridin-3-ylpyran-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1cc(=O)c(OCc2ccc(Cl)c(Cl)c2)co1 |
| InChI | InChI=1S/C18H12Cl2N2O4/c19-13-4-3-11(6-14(13)20)9-25-17-10-26-16(7-15(17)23)18(24)22-12-2-1-5-21-8-12/h1-8,10H,9H2,(H,22,24) |
| InChIKey | RBXZYLPJLPXRQX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |