C19H15NO6S — CID 101485712
[4-oxo-6-(phenylcarbamoyl)pyran-3-yl] 4-methylbenzenesulfonate (PubChem CID 101485712) has the molecular formula C19H15NO6S and a molecular weight of 385.40 g/mol. Its IUPAC name is [4-oxo-6-(phenylcarbamoyl)pyran-3-yl] 4-methylbenzenesulfonate.
| Compound Name | [4-oxo-6-(phenylcarbamoyl)pyran-3-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 101485712 |
| Molecular Formula | C19H15NO6S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.06 |
| IUPAC Name | [4-oxo-6-(phenylcarbamoyl)pyran-3-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2coc(C(=O)Nc3ccccc3)cc2=O)cc1 |
| InChI | InChI=1S/C19H15NO6S/c1-13-7-9-15(10-8-13)27(23,24)26-18-12-25-17(11-16(18)21)19(22)20-14-5-3-2-4-6-14/h2-12H,1H3,(H,20,22) |
| InChIKey | NTRDWDUDQGFVGC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|