C26H22N2O7S2 — CID 142536597
[3-[[3-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate (PubChem CID 142536597) has the molecular formula C26H22N2O7S2 and a molecular weight of 538.60 g/mol. Its IUPAC name is [3-[[3-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [3-[[3-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 142536597 |
| Molecular Formula | C26H22N2O7S2 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | [3-[[3-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2cccc(NC(=O)Nc3cccc(OS(=O)(=O)c4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C26H22N2O7S2/c1-19-13-15-25(16-14-19)37(32,33)35-23-10-6-8-21(18-23)28-26(29)27-20-7-5-9-22(17-20)34-36(30,31)24-11-3-2-4-12-24/h2-18H,1H3,(H2,27,28,29) |
| InChIKey | JIJKLUOTRFHGGL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|