C32H26N4O8S2 — CID 155235085
bis[3-(phenylcarbamoylamino)phenyl] benzene-1,3-disulfonate (PubChem CID 155235085) has the molecular formula C32H26N4O8S2 and a molecular weight of 658.71 g/mol. Its IUPAC name is bis[3-(phenylcarbamoylamino)phenyl] benzene-1,3-disulfonate.
| Compound Name | bis[3-(phenylcarbamoylamino)phenyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 155235085 |
| Molecular Formula | C32H26N4O8S2 |
| Molecular Weight | 658.71 g/mol |
| Exact Mass | 658.12 |
| IUPAC Name | bis[3-(phenylcarbamoylamino)phenyl] benzene-1,3-disulfonate |
| SMILES | O=C(Nc1ccccc1)Nc1cccc(OS(=O)(=O)c2cccc(S(=O)(=O)Oc3cccc(NC(=O)Nc4ccccc4)c3)c2)c1 |
| InChI | InChI=1S/C32H26N4O8S2/c37-31(33-23-10-3-1-4-11-23)35-25-14-7-16-27(20-25)43-45(39,40)29-18-9-19-30(22-29)46(41,42)44-28-17-8-15-26(21-28)36-32(38)34-24-12-5-2-6-13-24/h1-22H,(H2,33,35,37)(H2,34,36,38) |
| InChIKey | MNKOSIOZKYAHEA-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.71 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|