C40H38N4O10S2 — CID 155659657
bis[3-[[3-(2-methylprop-2-enoxy)phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate (PubChem CID 155659657) has the molecular formula C40H38N4O10S2 and a molecular weight of 798.90 g/mol. Its IUPAC name is bis[3-[[3-(2-methylprop-2-enoxy)phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate.
| Compound Name | bis[3-[[3-(2-methylprop-2-enoxy)phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 155659657 |
| Molecular Formula | C40H38N4O10S2 |
| Molecular Weight | 798.90 g/mol |
| Exact Mass | 798.20 |
| IUPAC Name | bis[3-[[3-(2-methylprop-2-enoxy)phenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
| SMILES | C=C(C)COc1cccc(NC(=O)Nc2cccc(OS(=O)(=O)c3cccc(S(=O)(=O)Oc4cccc(NC(=O)Nc5cccc(OCC(=C)C)c5)c4)c3)c2)c1 |
| InChI | InChI=1S/C40H38N4O10S2/c1-27(2)25-51-33-14-5-10-29(20-33)41-39(45)43-31-12-7-16-35(22-31)53-55(47,48)37-18-9-19-38(24-37)56(49,50)54-36-17-8-13-32(23-36)44-40(46)42-30-11-6-15-34(21-30)52-26-28(3)4/h5-24H,1,3,25-26H2,2,4H3,(H2,41,43,45)(H2,42,44,46) |
| InChIKey | WCWUCKMNTCABJH-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 187.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.90 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|