C44H32Cl2N4O14S4 — CID 155659632
bis[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate (PubChem CID 155659632) has the molecular formula C44H32Cl2N4O14S4 and a molecular weight of 1039.93 g/mol. Its IUPAC name is bis[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate.
| Compound Name | bis[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
|---|---|
| PubChem CID | 155659632 |
| Molecular Formula | C44H32Cl2N4O14S4 |
| Molecular Weight | 1039.93 g/mol |
| Exact Mass | 1038.02 |
| IUPAC Name | bis[3-[[3-(4-chlorophenyl)sulfonyloxyphenyl]carbamoylamino]phenyl] benzene-1,3-disulfonate |
| SMILES | O=C(Nc1cccc(OS(=O)(=O)c2ccc(Cl)cc2)c1)Nc1cccc(OS(=O)(=O)c2cccc(S(=O)(=O)Oc3cccc(NC(=O)Nc4cccc(OS(=O)(=O)c5ccc(Cl)cc5)c4)c3)c2)c1 |
| InChI | InChI=1S/C44H32Cl2N4O14S4/c45-29-16-20-39(21-17-29)65(53,54)61-35-10-1-6-31(24-35)47-43(51)49-33-8-3-12-37(26-33)63-67(57,58)41-14-5-15-42(28-41)68(59,60)64-38-13-4-9-34(27-38)50-44(52)48-32-7-2-11-36(25-32)62-66(55,56)40-22-18-30(46)19-23-40/h1-28H,(H2,47,49,51)(H2,48,50,52) |
| InChIKey | OGMZWFULXQRFLF-UHFFFAOYSA-N |
| XLogP | 9.35 |
| TPSA | 255.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1039.93 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|