C38H30N4O10S2 — CID 155659642
[3-[(3-hydroxyphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-hydroxyphenyl)carbamoylamino]phenoxy]sulfonylphenyl]benzenesulfonate (PubChem CID 155659642) has the molecular formula C38H30N4O10S2 and a molecular weight of 766.81 g/mol. Its IUPAC name is [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-hydroxyphenyl)carbamoylamino]phenoxy]sulfonylphenyl]benzenesulfonate.
| Compound Name | [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-hydroxyphenyl)carbamoylamino]phenoxy]sulfonylphenyl]benzenesulfonate |
|---|---|
| PubChem CID | 155659642 |
| Molecular Formula | C38H30N4O10S2 |
| Molecular Weight | 766.81 g/mol |
| Exact Mass | 766.14 |
| IUPAC Name | [3-[(3-hydroxyphenyl)carbamoylamino]phenyl] 4-[4-[3-[(3-hydroxyphenyl)carbamoylamino]phenoxy]sulfonylphenyl]benzenesulfonate |
| SMILES | O=C(Nc1cccc(O)c1)Nc1cccc(OS(=O)(=O)c2ccc(-c3ccc(S(=O)(=O)Oc4cccc(NC(=O)Nc5cccc(O)c5)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C38H30N4O10S2/c43-31-9-1-5-27(21-31)39-37(45)41-29-7-3-11-33(23-29)51-53(47,48)35-17-13-25(14-18-35)26-15-19-36(20-16-26)54(49,50)52-34-12-4-8-30(24-34)42-38(46)40-28-6-2-10-32(44)22-28/h1-24,43-44H,(H2,39,41,45)(H2,40,42,46) |
| InChIKey | LTAASUJDTSZKPT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 209.46 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.81 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|