C38H30N4O8S2 — CID 155661552
[4-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] benzenesulfonate (PubChem CID 155661552) has the molecular formula C38H30N4O8S2 and a molecular weight of 734.81 g/mol. Its IUPAC name is [4-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] benzenesulfonate.
| Compound Name | [4-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 155661552 |
| Molecular Formula | C38H30N4O8S2 |
| Molecular Weight | 734.81 g/mol |
| Exact Mass | 734.15 |
| IUPAC Name | [4-[[4-[4-[[4-(benzenesulfonyloxy)phenyl]carbamoylamino]phenyl]phenyl]carbamoylamino]phenyl] benzenesulfonate |
| SMILES | O=C(Nc1ccc(OS(=O)(=O)c2ccccc2)cc1)Nc1ccc(-c2ccc(NC(=O)Nc3ccc(OS(=O)(=O)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C38H30N4O8S2/c43-37(41-31-19-23-33(24-20-31)49-51(45,46)35-7-3-1-4-8-35)39-29-15-11-27(12-16-29)28-13-17-30(18-14-28)40-38(44)42-32-21-25-34(26-22-32)50-52(47,48)36-9-5-2-6-10-36/h1-26H,(H2,39,41,43)(H2,40,42,44) |
| InChIKey | FFXSQZBKXLAVGT-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 734.81 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|