C20H18N2O6S2 — CID 22564943
phenyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzenesulfonate (PubChem CID 22564943) has the molecular formula C20H18N2O6S2 and a molecular weight of 446.51 g/mol. Its IUPAC name is phenyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzenesulfonate.
| Compound Name | phenyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzenesulfonate |
|---|---|
| PubChem CID | 22564943 |
| Molecular Formula | C20H18N2O6S2 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.06 |
| IUPAC Name | phenyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(S(=O)(=O)Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C20H18N2O6S2/c1-15-7-11-18(12-8-15)29(24,25)22-20(23)21-16-9-13-19(14-10-16)30(26,27)28-17-5-3-2-4-6-17/h2-14H,1H3,(H2,21,22,23) |
| InChIKey | GPOQVHDHHZFMSU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|