C31H32N4O8S2 — CID 139757137
1-(4-methylphenyl)sulfonyl-3-[4-[3-[4-[(4-methylphenyl)sulfonylcarbamoylamino]phenoxy]propoxy]phenyl]urea (PubChem CID 139757137) has the molecular formula C31H32N4O8S2 and a molecular weight of 652.75 g/mol. Its IUPAC name is 1-(4-methylphenyl)sulfonyl-3-[4-[3-[4-[(4-methylphenyl)sulfonylcarbamoylamino]phenoxy]propoxy]phenyl]urea.
| Compound Name | 1-(4-methylphenyl)sulfonyl-3-[4-[3-[4-[(4-methylphenyl)sulfonylcarbamoylamino]phenoxy]propoxy]phenyl]urea |
|---|---|
| PubChem CID | 139757137 |
| Molecular Formula | C31H32N4O8S2 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.17 |
| IUPAC Name | 1-(4-methylphenyl)sulfonyl-3-[4-[3-[4-[(4-methylphenyl)sulfonylcarbamoylamino]phenoxy]propoxy]phenyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(OCCCOc3ccc(NC(=O)NS(=O)(=O)c4ccc(C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H32N4O8S2/c1-22-4-16-28(17-5-22)44(38,39)34-30(36)32-24-8-12-26(13-9-24)42-20-3-21-43-27-14-10-25(11-15-27)33-31(37)35-45(40,41)29-18-6-23(2)7-19-29/h4-19H,3,20-21H2,1-2H3,(H2,32,34,36)(H2,33,35,37) |
| InChIKey | NHBJYHOUWMAWIA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|