C31H38N2O7S2 — CID 22564965
9-(4-methylphenyl)sulfonylnonyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 22564965) has the molecular formula C31H38N2O7S2 and a molecular weight of 614.79 g/mol. Its IUPAC name is 9-(4-methylphenyl)sulfonylnonyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | 9-(4-methylphenyl)sulfonylnonyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 22564965 |
| Molecular Formula | C31H38N2O7S2 |
| Molecular Weight | 614.79 g/mol |
| Exact Mass | 614.21 |
| IUPAC Name | 9-(4-methylphenyl)sulfonylnonyl 4-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)CCCCCCCCCOC(=O)c2ccc(NC(=O)NS(=O)(=O)c3ccc(C)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H38N2O7S2/c1-24-10-18-28(19-11-24)41(36,37)23-9-7-5-3-4-6-8-22-40-30(34)26-14-16-27(17-15-26)32-31(35)33-42(38,39)29-20-12-25(2)13-21-29/h10-21H,3-9,22-23H2,1-2H3,(H2,32,33,35) |
| InChIKey | OTHSKOJKOHNVEU-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 135.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.79 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|