C37H40N4O10S2 — CID 23070388
7-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyheptyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 23070388) has the molecular formula C37H40N4O10S2 and a molecular weight of 764.88 g/mol. Its IUPAC name is 7-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyheptyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | 7-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyheptyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 23070388 |
| Molecular Formula | C37H40N4O10S2 |
| Molecular Weight | 764.88 g/mol |
| Exact Mass | 764.22 |
| IUPAC Name | 7-[3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoyl]oxyheptyl 3-[(3-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1cccc(S(=O)(=O)NC(=O)Nc2cccc(C(=O)OCCCCCCCOC(=O)c3cccc(NC(=O)NS(=O)(=O)c4cccc(C)c4)c3)c2)c1 |
| InChI | InChI=1S/C37H40N4O10S2/c1-26-12-8-18-32(22-26)52(46,47)40-36(44)38-30-16-10-14-28(24-30)34(42)50-20-6-4-3-5-7-21-51-35(43)29-15-11-17-31(25-29)39-37(45)41-53(48,49)33-19-9-13-27(2)23-33/h8-19,22-25H,3-7,20-21H2,1-2H3,(H2,38,40,44)(H2,39,41,45) |
| InChIKey | NRTOKOWGEXJYSO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 203.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.88 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|